Products 52663-62-4
CAS 52663-62-4 appears in our catalog under these names: 2,2',3,3',4-Pentachlorobiphenyl, 2，2'，3，3'，4–Pentachlorobiphenyl, PCB 82, ROTI®Star, 5 mg, glass, PCB 82, PCB 82, Concentration: 100 µg/ml Solvent: Isooctane. Offered by: TRC, GLPBio, Roth, HPC Standards. Available pack sizes: 500mg, 1ml, 5mg, 1x5mg, 1x5ml.
1,2,3-trichloro-4-(2,3-dichlorophenyl)benzene (CAS 52663-62-4) is a chemical compound with the molecular formula C12H5Cl5 and a molecular weight of 326.4 g/mol. IUPAC name: 1,2,3-trichloro-4-(2,3-dichlorophenyl)benzene. InChIKey: AUGNBQPSMWGAJE-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl5 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 1,2,3-trichloro-4-(2,3-dichlorophenyl)benzene |
| InChIKey | AUGNBQPSMWGAJE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=C(C(=C(C=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,2',3,3',4-pentachlorobiphenyl, 2,2',3,3',4-Pentachloro-1,1'-biphenyl, 1,1'-Biphenyl, 2,2',3,3',4-pentachloro-, 2,3,4,2',3'-Pentachlorobiphenyl, 2,2',3,3',4'-Pentachlorobiphenyl, 1,2,3-trichloro-4-(2,3-dichlorophenyl)benzene, Arochlor 1254, Chlorodiphenyl (54% Cl), Chlorodiphenyl (54% Chlorine), Clorodifenili, cloro 54% [Italian]