CAS 70362-41-3 appears in our catalog under these names: 2,3,3',4,5'-Pentachloro-1,1'-biphenyl, PCB No. 108, PCB 108, ROTI®Star, 5 mg, glass, PCB 108. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, Roth, HPC Standards. Available pack sizes: 100mg, 5mg, 50mg, 25mg, 1x5mg.
1,2,3-trichloro-4-(3,5-dichlorophenyl)benzene (CAS 70362-41-3) is a chemical compound with the molecular formula C12H5Cl5 and a molecular weight of 326.4 g/mol. IUPAC name: 1,2,3-trichloro-4-(3,5-dichlorophenyl)benzene. InChIKey: MPCDNZSLJWJDNW-UHFFFAOYSA-N.
| Molecular formula | C12H5Cl5 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 1,2,3-trichloro-4-(3,5-dichlorophenyl)benzene |
| InChIKey | MPCDNZSLJWJDNW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C2=CC(=CC(=C2)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)