CAS 1219794-87-2 appears in our catalog under these names: 2,4',5-Trichlorobiphenyl-2',3',5',6'-d4, 98 atom % D, min 98% Chemical Purity, 2,4',5-Trichlorobiphenyl-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 1 mg.
1-chloro-2,3,5,6-tetradeuterio-4-(2,5-dichlorophenyl)benzene (CAS 1219794-87-2) is a chemical compound with the molecular formula C12H7Cl3 and a molecular weight of 261.6 g/mol. IUPAC name: 1-chloro-2,3,5,6-tetradeuterio-4-(2,5-dichlorophenyl)benzene. InChIKey: VAHKBZSAUKPEOV-RHQRLBAQSA-N.
| Molecular formula | C12H7Cl3 |
|---|---|
| Molecular weight | 261.6 g/mol |
| IUPAC name | 1-chloro-2,3,5,6-tetradeuterio-4-(2,5-dichlorophenyl)benzene |
| InChIKey | VAHKBZSAUKPEOV-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C2=C(C=CC(=C2)Cl)Cl)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)