Products 12674-11-2
CAS 12674-11-2 appears in our catalog under these names: Aroclor 1016 10 µg/mL in Cyclohexane, Aroclor 1016 100 µg/mL in Isooctane, Aroclor 1016 1000 µg/mL in Hexane, Aroclor 1016 1000 µg/mL in Methanol. Offered by: Dr. Ehrenstorfer. Available pack sizes: 10ml, 1ml.
1,3-dichloro-5-(3-chlorophenyl)benzene (CAS 12674-11-2) is a chemical compound with the molecular formula C12H7Cl3 and a molecular weight of 257.5 g/mol. IUPAC name: 1,3-dichloro-5-(3-chlorophenyl)benzene. InChIKey: RIBGNAJQTOXRDK-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl3 |
|---|---|
| Molecular weight | 257.5 g/mol |
| IUPAC name | 1,3-dichloro-5-(3-chlorophenyl)benzene |
| InChIKey | RIBGNAJQTOXRDK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)