CAS 15248-00-7 appears in our catalog under these names: 3,5,6-Trichloro-1,2-dihydroacenaphthylene, 98%, 3,5,6-Trichloroacenaphthene. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg, 25mg.
3,5,6-trichloro-1,2-dihydroacenaphthylene (CAS 15248-00-7) is a chemical compound with the molecular formula C12H7Cl3 and a molecular weight of 257.5 g/mol. IUPAC name: 3,5,6-trichloro-1,2-dihydroacenaphthylene. InChIKey: IBXKURPCEGNACT-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl3 |
|---|---|
| Molecular weight | 257.5 g/mol |
| IUPAC name | 3,5,6-trichloro-1,2-dihydroacenaphthylene |
| InChIKey | IBXKURPCEGNACT-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C3=C(C=CC1=C23)Cl)Cl)Cl |
Computed by PubChem (NCBI)