Products 93952-22-8
CAS 93952-22-8 appears in our catalog under these names: 3,4,5-Trichlorobiphenyl-2',3',4',5',6'-d5, 98 atom % D, min 98% Chemical Purity, 3,4,5-Trichlorobiphenyl-2′,3′,4′,5′,6′-d5. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 1 mg.
1,2,3,4,5-pentadeuterio-6-(3,4,5-trichlorophenyl)benzene (CAS 93952-22-8) is a chemical compound with the molecular formula C12H7Cl3 and a molecular weight of 262.6 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-(3,4,5-trichlorophenyl)benzene. InChIKey: BSFZSQRJGZHMMV-RALIUCGRSA-N.
| Molecular formula | C12H7Cl3 |
|---|---|
| Molecular weight | 262.6 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-(3,4,5-trichlorophenyl)benzene |
| InChIKey | BSFZSQRJGZHMMV-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CC(=C(C(=C2)Cl)Cl)Cl)[2H])[2H] |
Computed by PubChem (NCBI)