Products 1219798-66-9
CAS 1219798-66-9 appears in our catalog under these names: n-Pentyl 4-Hydroxybenzoate-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity, Pentyl 4-hydroxybenzoate-d4, D4-Pentylparaben, ISO 17034 RM, D4-Pentylparaben, 100 µg/ml in Acetonitrile, ISO 17034 CRM. Offered by: CDN, MedChemExpress, HPC Standards. Available pack sizes: 0,1g, 0,05g, 1 mg, 10mg, 1ml.
Pentyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate (CAS 1219798-66-9) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 212.28 g/mol. IUPAC name: pentyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate. InChIKey: ZNSSPLQZSUWFJT-KDWZCNHSSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 212.28 g/mol |
| IUPAC name | pentyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate |
| InChIKey | ZNSSPLQZSUWFJT-KDWZCNHSSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)OCCCCC)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)