Products 688361-45-7

CAS 688361-45-7 is the registry number for 2-Bromopropane-1,1,1-d3, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.

Structural formula: {0} (CAS {1})

2-bromo-1,1,1-trideuteriopropane (CAS 688361-45-7) is a chemical compound with the molecular formula C3H7Br and a molecular weight of 126.01 g/mol. IUPAC name: 2-bromo-1,1,1-trideuteriopropane. InChIKey: NAMYKGVDVNBCFQ-FIBGUPNXSA-N.

Identity
Molecular formulaC3H7Br
Molecular weight126.01 g/mol
IUPAC name2-bromo-1,1,1-trideuteriopropane
InChIKeyNAMYKGVDVNBCFQ-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])C(C)Br

Computed by PubChem (NCBI)