Products 1219803-41-4
CAS 1219803-41-4 appears in our catalog under these names: Phenothiazine-d8,NH, 98 atom % D, min 98% Chemical Purity, Phenothiazine–d8, Phenothiazine-d8, 99.0%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 10mg, 5 mg, 10 mg.
1,2,3,4,6,7,8,9-octadeuterio-10H-phenothiazine (CAS 1219803-41-4) is a chemical compound with the molecular formula C12H9NS and a molecular weight of 207.32 g/mol. IUPAC name: 1,2,3,4,6,7,8,9-octadeuterio-10H-phenothiazine. InChIKey: WJFKNYWRSNBZNX-PGRXLJNUSA-N.
| Molecular formula | C12H9NS |
|---|---|
| Molecular weight | 207.32 g/mol |
| IUPAC name | 1,2,3,4,6,7,8,9-octadeuterio-10H-phenothiazine |
| InChIKey | WJFKNYWRSNBZNX-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])NC3=C(C(=C(C(=C3S2)[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)