CAS 2682-45-3 appears in our catalog under these names: 2–Methylnaphtho(1,2–d)thiazole, 2-Methylnaphtho[1,2-d]thiazole, 98% , 2-Methylnaphtho[1,2-d]thiazole, >98.0%(GC), 2-Methylnaphtho[1,2-d]thiazole 98%, 2-Methylnaphtho[1,2-d]thiazole, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 10g, 25g, 50g, 5g, 1g.
2-methylbenzo[e][1,3]benzothiazole (CAS 2682-45-3) is a chemical compound with the molecular formula C12H9NS and a molecular weight of 199.27 g/mol. IUPAC name: 2-methylbenzo[e][1,3]benzothiazole. InChIKey: OUXMJRMYZCEVKO-UHFFFAOYSA-N.
| Molecular formula | C12H9NS |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | 2-methylbenzo[e][1,3]benzothiazole |
| InChIKey | OUXMJRMYZCEVKO-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)