Products 20686-62-8
CAS 20686-62-8 is the registry number for 2-Methylnaphtho(2,1-d)thiazole. Offered by: TRC. Available pack sizes: 5g.
2-methylbenzo[g][1,3]benzothiazole (CAS 20686-62-8) is a chemical compound with the molecular formula C12H9NS and a molecular weight of 199.27 g/mol. IUPAC name: 2-methylbenzo[g][1,3]benzothiazole. InChIKey: OCRIUIGNOKGMOR-UHFFFAOYSA-N.
| Molecular formula | C12H9NS |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | 2-methylbenzo[g][1,3]benzothiazole |
| InChIKey | OCRIUIGNOKGMOR-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)
Synonyms:
2-Methylnaphtho[2,1-d]thiazole, Naphtho[2,1-d]thiazole, 2-methyl-, 2-Methylnaphtho(2,1-d)thiazole, 2-Methyl-naphtho(2,1-d)thiazole, Naphtho(2,1-d)thiazole, 2-methyl-, 2-methylbenzo[g][1,3]benzothiazole, 2-Methylnaphtho[2,1-d][1,3]thiazole, 2-methylbenzo[g]benzothiazole, OCRIUIGNOKGMOR-UHFFFAOYSA-, 2-Methylnaphtho[2,1-d]thiazole, 96%