Products 7428-91-3
CAS 7428-91-3 appears in our catalog under these names: Dibenzo(b,d)thiophen–2–amine, Dibenzo[b,d]thiophen-2-amine, >98.0%(GC)(T), Dibenzo[b,d]thiophen-2-amine 97%, Dibenzo[b,d]thiophen-2-amine, 97%, 97%, Dibenzo[b,d]thiophen-2-amine, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 100mg, 250mg, 5g, 25g, 100g, 10g.
Dibenzothiophen-2-amine (CAS 7428-91-3) is a chemical compound with the molecular formula C12H9NS and a molecular weight of 199.27 g/mol. IUPAC name: dibenzothiophen-2-amine. InChIKey: ICMMJWDNKMITSS-UHFFFAOYSA-N.
| Molecular formula | C12H9NS |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | dibenzothiophen-2-amine |
| InChIKey | ICMMJWDNKMITSS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)C=CC(=C3)N |
Computed by PubChem (NCBI)