Products 1219803-76-5
CAS 1219803-76-5 appears in our catalog under these names: Ethyl-d5 4-Aminobenzoate, 99 atom % D, min 98% Chemical Purity, Benzocaine–(ethyl–d5), Benzocaine-(ethyl-d5), 99.0%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10mg, 10 mg, 5 mg.
1,1,2,2,2-pentadeuterioethyl 4-aminobenzoate (CAS 1219803-76-5) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 170.22 g/mol. IUPAC name: 1,1,2,2,2-pentadeuterioethyl 4-aminobenzoate. InChIKey: BLFLLBZGZJTVJG-ZBJDZAJPSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 170.22 g/mol |
| IUPAC name | 1,1,2,2,2-pentadeuterioethyl 4-aminobenzoate |
| InChIKey | BLFLLBZGZJTVJG-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)