CAS 135201-50-2 is the registry number for (S)-4-Hydroxy Propranolol Hydrobromide. Offered by: TRC. Available pack sizes: 50mg, 5mg.
4-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]naphthalen-1-ol;hydrochloride (CAS 135201-50-2) is a chemical compound with the molecular formula C16H22ClNO3 and a molecular weight of 311.80 g/mol. IUPAC name: 4-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]naphthalen-1-ol;hydrochloride. InChIKey: ROUJENUXWIFONU-YDALLXLXSA-N.
| Molecular formula | C16H22ClNO3 |
|---|---|
| Molecular weight | 311.80 g/mol |
| IUPAC name | 4-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]naphthalen-1-ol;hydrochloride |
| InChIKey | ROUJENUXWIFONU-YDALLXLXSA-N |
| SMILES | CC(C)NC[C@@H](COC1=CC=C(C2=CC=CC=C21)O)O.Cl |
Computed by PubChem (NCBI)