Products 1219804-48-4
CAS 1219804-48-4 is the registry number for 1,5-Dinitronaphthalene-d6, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.
1,2,3,5,6,7-hexadeuterio-4,8-dinitronaphthalene (CAS 1219804-48-4) is a chemical compound with the molecular formula C10H6N2O4 and a molecular weight of 224.20 g/mol. IUPAC name: 1,2,3,5,6,7-hexadeuterio-4,8-dinitronaphthalene. InChIKey: ZUTCJXFCHHDFJS-MZWXYZOWSA-N.
| Molecular formula | C10H6N2O4 |
|---|---|
| Molecular weight | 224.20 g/mol |
| IUPAC name | 1,2,3,5,6,7-hexadeuterio-4,8-dinitronaphthalene |
| InChIKey | ZUTCJXFCHHDFJS-MZWXYZOWSA-N |
| SMILES | [2H]C1=C(C2=C(C(=C(C(=C2[N+](=O)[O-])[2H])[2H])[2H])C(=C1[2H])[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)