CAS 2973-15-1 appears in our catalog under these names: 1-(2-Nitrophenyl)-1h-pyrrole-2,5-dione, 95%, 1-(2-Nitrophenyl)-1H-pyrrole-2,5-dione, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-(2-nitrophenyl)pyrrole-2,5-dione (CAS 2973-15-1) is a chemical compound with the molecular formula C10H6N2O4 and a molecular weight of 218.17 g/mol. IUPAC name: 1-(2-nitrophenyl)pyrrole-2,5-dione. InChIKey: SCXAYTWCHGRQPA-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O4 |
|---|---|
| Molecular weight | 218.17 g/mol |
| IUPAC name | 1-(2-nitrophenyl)pyrrole-2,5-dione |
| InChIKey | SCXAYTWCHGRQPA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C(=O)C=CC2=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)