CAS 929971-97-1 is the registry number for 7H-(1,3)Dioxolo(4,5-g)cinnoline-3-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
[1,3]dioxolo[4,5-g]cinnoline-3-carboxylic acid (CAS 929971-97-1) is a chemical compound with the molecular formula C10H6N2O4 and a molecular weight of 218.17 g/mol. IUPAC name: [1,3]dioxolo[4,5-g]cinnoline-3-carboxylic acid. InChIKey: FQKMAEWPSZEOIR-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O4 |
|---|---|
| Molecular weight | 218.17 g/mol |
| IUPAC name | [1,3]dioxolo[4,5-g]cinnoline-3-carboxylic acid |
| InChIKey | FQKMAEWPSZEOIR-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)C=C(N=N3)C(=O)O |
Computed by PubChem (NCBI)