CAS 84670-42-8 appears in our catalog under these names: 1,8-Naphthyridine-2,7-dicarboxylic acid, 98%, 1,8-Naphthyridine-2,7-dicarboxylic acid 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 50mg, 100mg, 250mg, 1g.
1,8-naphthyridine-2,7-dicarboxylic acid (CAS 84670-42-8) is a chemical compound with the molecular formula C10H6N2O4 and a molecular weight of 218.17 g/mol. IUPAC name: 1,8-naphthyridine-2,7-dicarboxylic acid. InChIKey: QMLKMVUDVDYESY-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O4 |
|---|---|
| Molecular weight | 218.17 g/mol |
| IUPAC name | 1,8-naphthyridine-2,7-dicarboxylic acid |
| InChIKey | QMLKMVUDVDYESY-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C=CC(=N2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)