Products 1219805-26-1

CAS 1219805-26-1 is the registry number for (±)-1-Phenyl-2-methylaminopropane-1,1,2,3,3,3-d6 HCl, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g.

Structural formula: {0} (CAS {1})

1,1,1,2,3,3-hexadeuterio-N-methyl-3-phenylpropan-2-amine;hydrochloride (CAS 1219805-26-1) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 191.73 g/mol. IUPAC name: 1,1,1,2,3,3-hexadeuterio-N-methyl-3-phenylpropan-2-amine;hydrochloride. InChIKey: TWXDDNPPQUTEOV-PEIUVIDGSA-N.

Identity
Molecular formulaC10H16ClN
Molecular weight191.73 g/mol
IUPAC name1,1,1,2,3,3-hexadeuterio-N-methyl-3-phenylpropan-2-amine;hydrochloride
InChIKeyTWXDDNPPQUTEOV-PEIUVIDGSA-N
SMILES[2H]C([2H])([2H])C([2H])(C([2H])([2H])C1=CC=CC=C1)NC.Cl

Computed by PubChem (NCBI)