CAS 1219805-26-1 is the registry number for (±)-1-Phenyl-2-methylaminopropane-1,1,2,3,3,3-d6 HCl, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g.
1,1,1,2,3,3-hexadeuterio-N-methyl-3-phenylpropan-2-amine;hydrochloride (CAS 1219805-26-1) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 191.73 g/mol. IUPAC name: 1,1,1,2,3,3-hexadeuterio-N-methyl-3-phenylpropan-2-amine;hydrochloride. InChIKey: TWXDDNPPQUTEOV-PEIUVIDGSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 191.73 g/mol |
| IUPAC name | 1,1,1,2,3,3-hexadeuterio-N-methyl-3-phenylpropan-2-amine;hydrochloride |
| InChIKey | TWXDDNPPQUTEOV-PEIUVIDGSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])C1=CC=CC=C1)NC.Cl |
Computed by PubChem (NCBI)