Products 1219805-60-3
CAS 1219805-60-3 is the registry number for 3-Bromotoluene-2,4,6-d3, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
2-bromo-1,3,5-trideuterio-4-methylbenzene (CAS 1219805-60-3) is a chemical compound with the molecular formula C7H7Br and a molecular weight of 174.05 g/mol. IUPAC name: 2-bromo-1,3,5-trideuterio-4-methylbenzene. InChIKey: WJIFKOVZNJTSGO-QGZYMEECSA-N.
| Molecular formula | C7H7Br |
|---|---|
| Molecular weight | 174.05 g/mol |
| IUPAC name | 2-bromo-1,3,5-trideuterio-4-methylbenzene |
| InChIKey | WJIFKOVZNJTSGO-QGZYMEECSA-N |
| SMILES | [2H]C1=CC(=C(C(=C1C)[2H])Br)[2H] |
Computed by PubChem (NCBI)