Products 56444-57-6

CAS 56444-57-6 is the registry number for 2-Bromotoluene-3,4,5,6-d4, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.

Structural formula: {0} (CAS {1})

1-bromo-2,3,4,5-tetradeuterio-6-methylbenzene (CAS 56444-57-6) is a chemical compound with the molecular formula C7H7Br and a molecular weight of 175.06 g/mol. IUPAC name: 1-bromo-2,3,4,5-tetradeuterio-6-methylbenzene. InChIKey: QSSXJPIWXQTSIX-QFFDRWTDSA-N.

Identity
Molecular formulaC7H7Br
Molecular weight175.06 g/mol
IUPAC name1-bromo-2,3,4,5-tetradeuterio-6-methylbenzene
InChIKeyQSSXJPIWXQTSIX-QFFDRWTDSA-N
SMILES[2H]C1=C(C(=C(C(=C1[2H])C)Br)[2H])[2H]

Computed by PubChem (NCBI)