CAS 1219805-74-9 is the registry number for 3,4,5-Trimethoxy-d9-benzyl Alcohol, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
[3,4,5-tris(trideuteriomethoxy)phenyl]methanol (CAS 1219805-74-9) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 207.27 g/mol. IUPAC name: [3,4,5-tris(trideuteriomethoxy)phenyl]methanol. InChIKey: QPHLRCUCFDXGLY-GQALSZNTSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | [3,4,5-tris(trideuteriomethoxy)phenyl]methanol |
| InChIKey | QPHLRCUCFDXGLY-GQALSZNTSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=CC(=C1OC([2H])([2H])[2H])OC([2H])([2H])[2H])CO |
Computed by PubChem (NCBI)