Products 1219805-74-9

CAS 1219805-74-9 is the registry number for 3,4,5-Trimethoxy-d9-benzyl Alcohol, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.

Structural formula: {0} (CAS {1})

[3,4,5-tris(trideuteriomethoxy)phenyl]methanol (CAS 1219805-74-9) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 207.27 g/mol. IUPAC name: [3,4,5-tris(trideuteriomethoxy)phenyl]methanol. InChIKey: QPHLRCUCFDXGLY-GQALSZNTSA-N.

Identity
Molecular formulaC10H14O4
Molecular weight207.27 g/mol
IUPAC name[3,4,5-tris(trideuteriomethoxy)phenyl]methanol
InChIKeyQPHLRCUCFDXGLY-GQALSZNTSA-N
SMILES[2H]C([2H])([2H])OC1=CC(=CC(=C1OC([2H])([2H])[2H])OC([2H])([2H])[2H])CO

Computed by PubChem (NCBI)