Products 1219805-99-8
CAS 1219805-99-8 appears in our catalog under these names: Doxofylline-d6 (dimethyl-d6), 99 atom % D, min 98% Chemical Purity, Doxofylline–d6, Doxofylline-d6, 99.67%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1mg, 1 mg.
7-(1,3-dioxolan-2-ylmethyl)-1,3-bis(trideuteriomethyl)purine-2,6-dione (CAS 1219805-99-8) is a chemical compound with the molecular formula C11H14N4O4 and a molecular weight of 272.29 g/mol. IUPAC name: 7-(1,3-dioxolan-2-ylmethyl)-1,3-bis(trideuteriomethyl)purine-2,6-dione. InChIKey: HWXIGFIVGWUZAO-WFGJKAKNSA-N.
| Molecular formula | C11H14N4O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | 7-(1,3-dioxolan-2-ylmethyl)-1,3-bis(trideuteriomethyl)purine-2,6-dione |
| InChIKey | HWXIGFIVGWUZAO-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N1C2=C(C(=O)N(C1=O)C([2H])([2H])[2H])N(C=N2)CC3OCCO3 |
Computed by PubChem (NCBI)