Products 1220-94-6
CAS 1220-94-6 appears in our catalog under these names: 1-Amino-4-(methylamino)anthracene-9,10-dione, Disperse Violet 4, Disperse Violet 4, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, HPC Standards. Available pack sizes: 100mg, 1x10mg, 1x1ml.
1-amino-4-(methylamino)anthracene-9,10-dione (CAS 1220-94-6) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 1-amino-4-(methylamino)anthracene-9,10-dione. InChIKey: ICVRBKCRXNVOJC-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 1-amino-4-(methylamino)anthracene-9,10-dione |
| InChIKey | ICVRBKCRXNVOJC-UHFFFAOYSA-N |
| SMILES | CNC1=C2C(=C(C=C1)N)C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)
Synonyms:
Disperse violet 4, 1-Amino-4-(methylamino)anthraquinone, 9,10-Anthracenedione, 1-amino-4-(methylamino)-, 1-amino-4-(methylamino)anthracene-9,10-dione, Solvent violet 12, 1-Amino-4-(methylamino)-9,10-anthracenedione, Oracet Violet B, Amacel Violet 6B, Supracet Violet 2B, Microsetile Violet B