Products 1220356-33-1
CAS 1220356-33-1 is the registry number for Caffeine-D10, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
8-deuterio-1,3,7-tris(trideuteriomethyl)purine-2,6-dione (CAS 1220356-33-1) is a chemical compound with the molecular formula C8H10N4O2 and a molecular weight of 204.25 g/mol. IUPAC name: 8-deuterio-1,3,7-tris(trideuteriomethyl)purine-2,6-dione. InChIKey: RYYVLZVUVIJVGH-LSURFNHSSA-N.
| Molecular formula | C8H10N4O2 |
|---|---|
| Molecular weight | 204.25 g/mol |
| IUPAC name | 8-deuterio-1,3,7-tris(trideuteriomethyl)purine-2,6-dione |
| InChIKey | RYYVLZVUVIJVGH-LSURFNHSSA-N |
| SMILES | [2H]C1=NC2=C(N1C([2H])([2H])[2H])C(=O)N(C(=O)N2C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)