Products 202282-98-2
CAS 202282-98-2 appears in our catalog under these names: Caffeine-(3-methyl-13C), Caffeine-13C, >95% (HPLC), Caffeine-13C. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 10mg.
1,7-dimethyl-3-(113C)methylpurine-2,6-dione (CAS 202282-98-2) is a chemical compound with the molecular formula C8H10N4O2 and a molecular weight of 195.18 g/mol. IUPAC name: 1,7-dimethyl-3-(113C)methylpurine-2,6-dione. InChIKey: RYYVLZVUVIJVGH-VQEHIDDOSA-N.
| Molecular formula | C8H10N4O2 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | 1,7-dimethyl-3-(113C)methylpurine-2,6-dione |
| InChIKey | RYYVLZVUVIJVGH-VQEHIDDOSA-N |
| SMILES | CN1C=NC2=C1C(=O)N(C(=O)N2[13CH3])C |
Computed by PubChem (NCBI)