CAS 1220423-63-1 is the registry number for 5-Bromo-2-(2,2,2-trifluoroethoxy)nicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid (CAS 1220423-63-1) is a chemical compound with the molecular formula C8H5BrF3NO3 and a molecular weight of 300.03 g/mol. IUPAC name: 5-bromo-2-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid. InChIKey: NKUNIKDJJQXFDM-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO3 |
|---|---|
| Molecular weight | 300.03 g/mol |
| IUPAC name | 5-bromo-2-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid |
| InChIKey | NKUNIKDJJQXFDM-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)OCC(F)(F)F)Br |
Computed by PubChem (NCBI)