Products 951231-87-1
CAS 951231-87-1 is the registry number for 1-Bromo-5-methoxy-2-nitro-4-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
1-bromo-5-methoxy-2-nitro-4-(trifluoromethyl)benzene (CAS 951231-87-1) is a chemical compound with the molecular formula C8H5BrF3NO3 and a molecular weight of 300.03 g/mol. IUPAC name: 1-bromo-5-methoxy-2-nitro-4-(trifluoromethyl)benzene. InChIKey: ZQFYMNIMOATSOG-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO3 |
|---|---|
| Molecular weight | 300.03 g/mol |
| IUPAC name | 1-bromo-5-methoxy-2-nitro-4-(trifluoromethyl)benzene |
| InChIKey | ZQFYMNIMOATSOG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(F)(F)F)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)