Products 2092929-95-6
CAS 2092929-95-6 is the registry number for 1-Bromo-4-methoxy-5-nitro-2-trifluoromethyl-benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-bromo-4-methoxy-5-nitro-2-(trifluoromethyl)benzene (CAS 2092929-95-6) is a chemical compound with the molecular formula C8H5BrF3NO3 and a molecular weight of 300.03 g/mol. IUPAC name: 1-bromo-4-methoxy-5-nitro-2-(trifluoromethyl)benzene. InChIKey: SVRSYJPCHJIUBR-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO3 |
|---|---|
| Molecular weight | 300.03 g/mol |
| IUPAC name | 1-bromo-4-methoxy-5-nitro-2-(trifluoromethyl)benzene |
| InChIKey | SVRSYJPCHJIUBR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(F)(F)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)