CAS 2301067-81-0 is the registry number for 1-Bromo-2-(2,2-difluoro-ethoxy)-3-fluoro-5-nitro-benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-bromo-2-(2,2-difluoroethoxy)-3-fluoro-5-nitrobenzene (CAS 2301067-81-0) is a chemical compound with the molecular formula C8H5BrF3NO3 and a molecular weight of 300.03 g/mol. IUPAC name: 1-bromo-2-(2,2-difluoroethoxy)-3-fluoro-5-nitrobenzene. InChIKey: UOZWMQCBSOCATF-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO3 |
|---|---|
| Molecular weight | 300.03 g/mol |
| IUPAC name | 1-bromo-2-(2,2-difluoroethoxy)-3-fluoro-5-nitrobenzene |
| InChIKey | UOZWMQCBSOCATF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)OCC(F)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)