Products 1220451-37-5
CAS 1220451-37-5 is the registry number for (4aR,9aS)-4,4a,9,9a-Tetrahydro-6-nitroindeno[2,1-b]-1,4-oxazin-3(2H)-one, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(4aR,9aS)-6-nitro-4,4a,9,9a-tetrahydroindeno[2,1-b][1,4]oxazin-3-one (CAS 1220451-37-5) is a chemical compound with the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. IUPAC name: (4aR,9aS)-6-nitro-4,4a,9,9a-tetrahydroindeno[2,1-b][1,4]oxazin-3-one. InChIKey: WOFOPBPTSJFMKN-GXSJLCMTSA-N.
| Molecular formula | C11H10N2O4 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | (4aR,9aS)-6-nitro-4,4a,9,9a-tetrahydroindeno[2,1-b][1,4]oxazin-3-one |
| InChIKey | WOFOPBPTSJFMKN-GXSJLCMTSA-N |
| SMILES | C1[C@H]2[C@@H](C3=C1C=CC(=C3)[N+](=O)[O-])NC(=O)CO2 |
Computed by PubChem (NCBI)