Products 923682-07-9
CAS 923682-07-9 appears in our catalog under these names: 3-[(5-Methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoic acid, 95%, 3-((5-Methyl-1,2,4-oxadiazol-3-yl)methoxy)benzoic acid, 95%, 3-((5-Methyl-1,2,4-oxadiazol-3-yl)methoxy)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoic acid (CAS 923682-07-9) is a chemical compound with the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. IUPAC name: 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoic acid. InChIKey: MXTQTENLUSJLFY-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O4 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]benzoic acid |
| InChIKey | MXTQTENLUSJLFY-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NO1)COC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)