CAS 148673-98-7 appears in our catalog under these names: 3-(2,4-Dioxo-3,4-dihydroquinazolin-1(2h)-yl)propanoic acid, 95%, 3-(2,4-Dioxo-3,4-dihydroquinazolin-1(2H)-yl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(2,4-dioxoquinazolin-1-yl)propanoic acid (CAS 148673-98-7) is a chemical compound with the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. IUPAC name: 3-(2,4-dioxoquinazolin-1-yl)propanoic acid. InChIKey: JVMIILRABUCELC-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O4 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 3-(2,4-dioxoquinazolin-1-yl)propanoic acid |
| InChIKey | JVMIILRABUCELC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=O)N2CCC(=O)O |
Computed by PubChem (NCBI)