CAS 2279124-57-9 appears in our catalog under these names: 2-Methoxy-5-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid, 95%, 2-Methoxy-5-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-methoxy-5-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid (CAS 2279124-57-9) is a chemical compound with the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. IUPAC name: 2-methoxy-5-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid. InChIKey: ZZQYLMBMIDRYDX-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O4 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 2-methoxy-5-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid |
| InChIKey | ZZQYLMBMIDRYDX-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NO1)C2=CC(=C(C=C2)OC)C(=O)O |
Computed by PubChem (NCBI)