CAS 869947-94-4 is the registry number for (3-Methyl-2,4-dioxo-3,4-dihydroquinazolin-1(2h)-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
2-(3-methyl-2,4-dioxoquinazolin-1-yl)acetic acid (CAS 869947-94-4) is a chemical compound with the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. IUPAC name: 2-(3-methyl-2,4-dioxoquinazolin-1-yl)acetic acid. InChIKey: CUELILSJQNHUOS-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O4 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 2-(3-methyl-2,4-dioxoquinazolin-1-yl)acetic acid |
| InChIKey | CUELILSJQNHUOS-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=CC=CC=C2N(C1=O)CC(=O)O |
Computed by PubChem (NCBI)