Products 1220518-09-1
CAS 1220518-09-1 is the registry number for 2,4-Dichloro-6-fluoropyrido[2,3-d]pyrimidine, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,4-dichloro-6-fluoropyrido[2,3-d]pyrimidine (CAS 1220518-09-1) is a chemical compound with the molecular formula C7H2Cl2FN3 and a molecular weight of 218.01 g/mol. IUPAC name: 2,4-dichloro-6-fluoropyrido[2,3-d]pyrimidine. InChIKey: UTXNBSZGIUHQOL-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2FN3 |
|---|---|
| Molecular weight | 218.01 g/mol |
| IUPAC name | 2,4-dichloro-6-fluoropyrido[2,3-d]pyrimidine |
| InChIKey | UTXNBSZGIUHQOL-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=NC(=N2)Cl)Cl)F |
Computed by PubChem (NCBI)