Products 1824318-03-7
CAS 1824318-03-7 appears in our catalog under these names: 2,4-DICHLORO-7-FLUOROPYRIDO[3,2-D]PYRIMIDINE, 95%, 95%, 2,4-Dichloro-7-fluoropyrido[3,2-d]pyrimidine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2,4-dichloro-7-fluoropyrido[3,2-d]pyrimidine (CAS 1824318-03-7) is a chemical compound with the molecular formula C7H2Cl2FN3 and a molecular weight of 218.01 g/mol. IUPAC name: 2,4-dichloro-7-fluoropyrido[3,2-d]pyrimidine. InChIKey: URIQIIULNJZAGS-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2FN3 |
|---|---|
| Molecular weight | 218.01 g/mol |
| IUPAC name | 2,4-dichloro-7-fluoropyrido[3,2-d]pyrimidine |
| InChIKey | URIQIIULNJZAGS-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1N=C(N=C2Cl)Cl)F |
Computed by PubChem (NCBI)