Products 2751563-11-6
CAS 2751563-11-6 is the registry number for 2,4-Dichloro-5-fluoropyrido[3,4-d]pyrimidine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-5-fluoropyrido[3,4-d]pyrimidine (CAS 2751563-11-6) is a chemical compound with the molecular formula C7H2Cl2FN3 and a molecular weight of 218.01 g/mol. IUPAC name: 2,4-dichloro-5-fluoropyrido[3,4-d]pyrimidine. InChIKey: ZLGBHUVDZCSPPF-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2FN3 |
|---|---|
| Molecular weight | 218.01 g/mol |
| IUPAC name | 2,4-dichloro-5-fluoropyrido[3,4-d]pyrimidine |
| InChIKey | ZLGBHUVDZCSPPF-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C=N1)F)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)