CAS 2454396-94-0 appears in our catalog under these names: 4,7-Dichloro-8-fluoropyrido(4,3-d)pyrimidine, 97%, 4,7-Dichloro-8-fluoropyrido[4,3-d]pyrimidine, 97%, 97%, 4,7-Dichloro-8-fluoropyrido[4,3-d]pyrimidine, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
4,7-dichloro-8-fluoropyrido[4,3-d]pyrimidine (CAS 2454396-94-0) is a chemical compound with the molecular formula C7H2Cl2FN3 and a molecular weight of 218.01 g/mol. IUPAC name: 4,7-dichloro-8-fluoropyrido[4,3-d]pyrimidine. InChIKey: QLYAWOKSYVXHSX-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2FN3 |
|---|---|
| Molecular weight | 218.01 g/mol |
| IUPAC name | 4,7-dichloro-8-fluoropyrido[4,3-d]pyrimidine |
| InChIKey | QLYAWOKSYVXHSX-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=N1)Cl)F)N=CN=C2Cl |
Computed by PubChem (NCBI)