CAS 1220694-88-1 is the registry number for 8-Bromoisoquinolin-6-ol. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg, 500mg, 250mg.
8-bromoisoquinolin-6-ol (CAS 1220694-88-1) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 8-bromoisoquinolin-6-ol. InChIKey: SVMOLLGJWZXMCX-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 8-bromoisoquinolin-6-ol |
| InChIKey | SVMOLLGJWZXMCX-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C(C=C(C=C21)O)Br |
Computed by PubChem (NCBI)