CAS 1221237-91-7 is the registry number for 4-(9,9-Diphenyl-9H-fluoren-2-yl)-N-phenylaniline, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
4-(9,9-diphenylfluoren-2-yl)-N-phenylaniline (CAS 1221237-91-7) is a chemical compound with the molecular formula C37H27N and a molecular weight of 485.6 g/mol. IUPAC name: 4-(9,9-diphenylfluoren-2-yl)-N-phenylaniline. InChIKey: NKAXJJMIYBGZDK-UHFFFAOYSA-N.
| Molecular formula | C37H27N |
|---|---|
| Molecular weight | 485.6 g/mol |
| IUPAC name | 4-(9,9-diphenylfluoren-2-yl)-N-phenylaniline |
| InChIKey | NKAXJJMIYBGZDK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=CC=CC=C3C4=C2C=C(C=C4)C5=CC=C(C=C5)NC6=CC=CC=C6)C7=CC=CC=C7 |
Computed by PubChem (NCBI)