CAS 1613331-99-9 is the registry number for N–(1,1′–Biphenyl)–4–yl–9,9–diphenyl–9H–fluoren–3–amine. Offered by: GLPBio. Available pack sizes: 1g, 25g, 5g.
9,9-diphenyl-N-(4-phenylphenyl)fluoren-3-amine (CAS 1613331-99-9) is a chemical compound with the molecular formula C37H27N and a molecular weight of 485.6 g/mol. IUPAC name: 9,9-diphenyl-N-(4-phenylphenyl)fluoren-3-amine. InChIKey: QTPVZBREDRVQMC-UHFFFAOYSA-N.
| Molecular formula | C37H27N |
|---|---|
| Molecular weight | 485.6 g/mol |
| IUPAC name | 9,9-diphenyl-N-(4-phenylphenyl)fluoren-3-amine |
| InChIKey | QTPVZBREDRVQMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC4=C(C=C3)C(C5=CC=CC=C54)(C6=CC=CC=C6)C7=CC=CC=C7 |
Computed by PubChem (NCBI)