CAS 1607480-14-7 appears in our catalog under these names: 2–(3–Biphenylyl)amino–9,9–diphenylfluorene, 2-(3-Biphenylyl)amino-9,9-diphenylfluorene, >98.0%(HPLC)(N), N-([1,1'-Biphenyl]-3-yl)-9,9-diphenyl-9H-fluoren-2-amine, 9H-Fluoren-2-amine, N-[1,1'-biphenyl]-3-yl-9,9-diphenyl-, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 5g.
9,9-diphenyl-N-(3-phenylphenyl)fluoren-2-amine (CAS 1607480-14-7) is a chemical compound with the molecular formula C37H27N and a molecular weight of 485.6 g/mol. IUPAC name: 9,9-diphenyl-N-(3-phenylphenyl)fluoren-2-amine. InChIKey: BTGTUYUUWJAEQW-UHFFFAOYSA-N.
| Molecular formula | C37H27N |
|---|---|
| Molecular weight | 485.6 g/mol |
| IUPAC name | 9,9-diphenyl-N-(3-phenylphenyl)fluoren-2-amine |
| InChIKey | BTGTUYUUWJAEQW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)NC3=CC4=C(C=C3)C5=CC=CC=C5C4(C6=CC=CC=C6)C7=CC=CC=C7 |
Computed by PubChem (NCBI)