CAS 1853250-53-9 is the registry number for N-([1,1'-Biphenyl]-2-yl)-9,9-diphenyl-9H-fluoren-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
9,9-diphenyl-N-(2-phenylphenyl)fluoren-2-amine (CAS 1853250-53-9) is a chemical compound with the molecular formula C37H27N and a molecular weight of 485.6 g/mol. IUPAC name: 9,9-diphenyl-N-(2-phenylphenyl)fluoren-2-amine. InChIKey: UHTHOTNMHQDECN-UHFFFAOYSA-N.
| Molecular formula | C37H27N |
|---|---|
| Molecular weight | 485.6 g/mol |
| IUPAC name | 9,9-diphenyl-N-(2-phenylphenyl)fluoren-2-amine |
| InChIKey | UHTHOTNMHQDECN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2NC3=CC4=C(C=C3)C5=CC=CC=C5C4(C6=CC=CC=C6)C7=CC=CC=C7 |
Computed by PubChem (NCBI)