CAS 122142-14-7 appears in our catalog under these names: 5-Methyl-2-(2,2,2-trifluoroethoxy)aniline hydrochloride, 95%, 5-Methyl-2-(2,2,2-trifluoroethoxy)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-methyl-2-(2,2,2-trifluoroethoxy)aniline;hydrochloride (CAS 122142-14-7) is a chemical compound with the molecular formula C9H11ClF3NO and a molecular weight of 241.64 g/mol. IUPAC name: 5-methyl-2-(2,2,2-trifluoroethoxy)aniline;hydrochloride. InChIKey: DXJGXJGERXNADS-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF3NO |
|---|---|
| Molecular weight | 241.64 g/mol |
| IUPAC name | 5-methyl-2-(2,2,2-trifluoroethoxy)aniline;hydrochloride |
| InChIKey | DXJGXJGERXNADS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OCC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)