CAS 1373925-07-5 appears in our catalog under these names: 1-[3-(Trifluoromethoxy)phenyl]ethan-1-amine hydrochloride, 95%, 1–(3–(Trifluoromethoxy)phenyl)ethan–1–amine hydrochloride, 1-(3-(Trifluoromethoxy)phenyl)ethan-1-amine hydrochloride, 1-[3-(Trifluoromethoxy)phenyl]ethan-1-amine hydrochloride, 97%, 97%, 1-[3-(Trifluoromethoxy)phenyl]ethan-1-amine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 2,5g, 5g, 10g.
1-[3-(trifluoromethoxy)phenyl]ethanamine;hydrochloride (CAS 1373925-07-5) is a chemical compound with the molecular formula C9H11ClF3NO and a molecular weight of 241.64 g/mol. IUPAC name: 1-[3-(trifluoromethoxy)phenyl]ethanamine;hydrochloride. InChIKey: GILTYZBJXXHWGV-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF3NO |
|---|---|
| Molecular weight | 241.64 g/mol |
| IUPAC name | 1-[3-(trifluoromethoxy)phenyl]ethanamine;hydrochloride |
| InChIKey | GILTYZBJXXHWGV-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)OC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)