Products 849928-43-4

CAS 849928-43-4 is the registry number for 2-Amino-1-(4-trifluoromethyl-phenyl)-ethanol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-amino-1-[4-(trifluoromethyl)phenyl]ethanol;hydrochloride (CAS 849928-43-4) is a chemical compound with the molecular formula C9H11ClF3NO and a molecular weight of 241.64 g/mol. IUPAC name: 2-amino-1-[4-(trifluoromethyl)phenyl]ethanol;hydrochloride. InChIKey: MGAPTMAVPUDDLY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClF3NO
Molecular weight241.64 g/mol
IUPAC name2-amino-1-[4-(trifluoromethyl)phenyl]ethanol;hydrochloride
InChIKeyMGAPTMAVPUDDLY-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(CN)O)C(F)(F)F.Cl

Computed by PubChem (NCBI)