CAS 1391567-48-8 appears in our catalog under these names: (1S)-1-[3-(Trifluoromethoxy)phenyl]ethan-1-amine hydrochloride, 95%, (S)–1–(3–(Trifluoromethoxy)phenyl)ethanamine hydrochloride, (1S)-1-[3-(trifluoromethoxy)phenyl]ethan-1-amine hydrochloride, 98%, 98%, (S)-1-(3-(Trifluoromethoxy)phenyl)ethanamine hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 100mg, 1g.
(1S)-1-[3-(trifluoromethoxy)phenyl]ethanamine;hydrochloride (CAS 1391567-48-8) is a chemical compound with the molecular formula C9H11ClF3NO and a molecular weight of 241.64 g/mol. IUPAC name: (1S)-1-[3-(trifluoromethoxy)phenyl]ethanamine;hydrochloride. InChIKey: GILTYZBJXXHWGV-RGMNGODLSA-N.
| Molecular formula | C9H11ClF3NO |
|---|---|
| Molecular weight | 241.64 g/mol |
| IUPAC name | (1S)-1-[3-(trifluoromethoxy)phenyl]ethanamine;hydrochloride |
| InChIKey | GILTYZBJXXHWGV-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)OC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)