CAS 12217-79-7 appears in our catalog under these names: Disperse Blue 56 (Technical Grade), 1,5-Diaminochloro-4,8-dihydroxy-9,10-anthracenedione. Offered by: TRC, Chemat. Available pack sizes: 1g, 2,5g, 5g, 500g, 2.5kg, 25g, 100g.
1,5-diamino-2-chloro-4,8-dihydroxyanthracene-9,10-dione (CAS 12217-79-7) is a chemical compound with the molecular formula C14H9ClN2O4 and a molecular weight of 304.68 g/mol. IUPAC name: 1,5-diamino-2-chloro-4,8-dihydroxyanthracene-9,10-dione. InChIKey: SIRMWLMEYFPGAD-UHFFFAOYSA-N.
| Molecular formula | C14H9ClN2O4 |
|---|---|
| Molecular weight | 304.68 g/mol |
| IUPAC name | 1,5-diamino-2-chloro-4,8-dihydroxyanthracene-9,10-dione |
| InChIKey | SIRMWLMEYFPGAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1N)C(=O)C3=C(C2=O)C(=C(C=C3O)Cl)N)O |
Computed by PubChem (NCBI)