CAS 1255147-24-0 appears in our catalog under these names: 5-Chloro-2-(4-cyano-2-methoxyphenoxy)nicotinic acid, 95%, 5-Chloro-2-(4-cyano-2-methoxyphenoxy)nicotinic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-chloro-2-(4-cyano-2-methoxyphenoxy)pyridine-3-carboxylic acid (CAS 1255147-24-0) is a chemical compound with the molecular formula C14H9ClN2O4 and a molecular weight of 304.68 g/mol. IUPAC name: 5-chloro-2-(4-cyano-2-methoxyphenoxy)pyridine-3-carboxylic acid. InChIKey: XPORMAZMHQWFRF-UHFFFAOYSA-N.
| Molecular formula | C14H9ClN2O4 |
|---|---|
| Molecular weight | 304.68 g/mol |
| IUPAC name | 5-chloro-2-(4-cyano-2-methoxyphenoxy)pyridine-3-carboxylic acid |
| InChIKey | XPORMAZMHQWFRF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C#N)OC2=C(C=C(C=N2)Cl)C(=O)O |
Computed by PubChem (NCBI)